AMINO ACIDS

     
Name Abbrev. pKa(side chain) FormulaStructure
Alanine Ala A CH3-CH(NH2)-COOH
*
Arginine Arg R 12.48 HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH
*
Asparagine Asn N H2N-CO-CH2-CH(NH2)-COOH
*
Aspartic acid Asp D 3.90 HOOC-CH2-CH(NH2)-COOH
*
Cysteine Cys C 8.37 HS-CH2-CH(NH2)-COOH
*
Glutamine Gln Q H2N-CO-(CH2)2-CH(NH2)-COOH
*
Glutamic acid Glu E 4.07 HOOC-(CH2)2-CH(NH2)-COOH
*
Glycine Gly G NH2-CH2-COOH
*
Histidine His H 6.04 N=C-NH-C=C-CH2-CH(NH2)-COOH|________|
*
Isoleucine Ile I CH3-CH2-CH(CH3)-CH(NH2)-COOH
*
Leucine Leu L (CH3)2-CH-CH2-CH(NH2)-COOH
*
Lysine Lys K 10.54 H2N-(CH2)4-CH(NH2)-COOH
*
Methionine Met M CH3-S-(CH2)2-CH(NH2)-COOH
*
Phenylalanine Phe F Ph-CH2-CH(NH2)-COOH
*
Proline Pro P NH-(CH2)3-CH-COOH |_________|
*
Serine Ser S HO-CH2-CH(NH2)-COOH
*
Threonine Thr T CH3-CH(OH)-CH(NH2)-COOH
*
Tryptophan Trp W Ph-NH-CH-C-CH2-CH(NH2)-COOH |_______|
*
Tyrosine Tyr Y 10.46 HO-p-Ph-CH2-CH(NH2)-COOH
*
Valine Val V CH3-CH(CH2)-CH(NH2)-COOH
*